C18H19Cl2NO2S — CID 121146241
1-(2,5-dichlorophenyl)sulfonyl-3-phenylazepane (PubChem CID 121146241) has the molecular formula C18H19Cl2NO2S and a molecular weight of 384.33 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-3-phenylazepane.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-3-phenylazepane |
|---|---|
| PubChem CID | 121146241 |
| Molecular Formula | C18H19Cl2NO2S |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-3-phenylazepane |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Cl)N1CCCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C18H19Cl2NO2S/c19-16-9-10-17(20)18(12-16)24(22,23)21-11-5-4-8-15(13-21)14-6-2-1-3-7-14/h1-3,6-7,9-10,12,15H,4-5,8,11,13H2 |
| InChIKey | QOZLGMMIFHTVFB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |