C18H18ClF2NO2S — CID 121146821
3-(4-chlorophenyl)-1-(3,5-difluorophenyl)sulfonylazepane (PubChem CID 121146821) has the molecular formula C18H18ClF2NO2S and a molecular weight of 385.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(3,5-difluorophenyl)sulfonylazepane.
| Compound Name | 3-(4-chlorophenyl)-1-(3,5-difluorophenyl)sulfonylazepane |
|---|---|
| PubChem CID | 121146821 |
| Molecular Formula | C18H18ClF2NO2S |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(3,5-difluorophenyl)sulfonylazepane |
| SMILES | O=S(=O)(c1cc(F)cc(F)c1)N1CCCCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H18ClF2NO2S/c19-15-6-4-13(5-7-15)14-3-1-2-8-22(12-14)25(23,24)18-10-16(20)9-17(21)11-18/h4-7,9-11,14H,1-3,8,12H2 |
| InChIKey | JYUCQBGZJSHREJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |