C22H22FNO2S — CID 90608901
3-(4-fluorophenyl)-1-naphthalen-2-ylsulfonylazepane (PubChem CID 90608901) has the molecular formula C22H22FNO2S and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-naphthalen-2-ylsulfonylazepane.
| Compound Name | 3-(4-fluorophenyl)-1-naphthalen-2-ylsulfonylazepane |
|---|---|
| PubChem CID | 90608901 |
| Molecular Formula | C22H22FNO2S |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-(4-fluorophenyl)-1-naphthalen-2-ylsulfonylazepane |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCCCC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H22FNO2S/c23-21-11-8-18(9-12-21)20-7-3-4-14-24(16-20)27(25,26)22-13-10-17-5-1-2-6-19(17)15-22/h1-2,5-6,8-13,15,20H,3-4,7,14,16H2 |
| InChIKey | CNZUTEPYLGRMCT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |