C16H16F3NO2S — CID 2082096
(3S)-1-naphthalen-2-ylsulfonyl-3-(trifluoromethyl)piperidine (PubChem CID 2082096) has the molecular formula C16H16F3NO2S and a molecular weight of 343.37 g/mol. Its IUPAC name is (3S)-1-naphthalen-2-ylsulfonyl-3-(trifluoromethyl)piperidine.
| Compound Name | (3S)-1-naphthalen-2-ylsulfonyl-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 2082096 |
| Molecular Formula | C16H16F3NO2S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (3S)-1-naphthalen-2-ylsulfonyl-3-(trifluoromethyl)piperidine |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C16H16F3NO2S/c17-16(18,19)14-6-3-9-20(11-14)23(21,22)15-8-7-12-4-1-2-5-13(12)10-15/h1-2,4-5,7-8,10,14H,3,6,9,11H2/t14-/m0/s1 |
| InChIKey | PINYFNIRAHLUNW-AWEZNQCLSA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |