C12H13BrF3NO2S — CID 2928083
1-(4-bromophenyl)sulfonyl-3-(trifluoromethyl)piperidine (PubChem CID 2928083) has the molecular formula C12H13BrF3NO2S and a molecular weight of 372.21 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-3-(trifluoromethyl)piperidine.
| Compound Name | 1-(4-bromophenyl)sulfonyl-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 2928083 |
| Molecular Formula | C12H13BrF3NO2S |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-3-(trifluoromethyl)piperidine |
| SMILES | O=S(=O)(c1ccc(Br)cc1)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H13BrF3NO2S/c13-10-3-5-11(6-4-10)20(18,19)17-7-1-2-9(8-17)12(14,15)16/h3-6,9H,1-2,7-8H2 |
| InChIKey | FNHCTSOARXZTLH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |