C13H14F6N2O2S — CID 170459185
2-(trifluoromethyl)-4-[3-(trifluoromethyl)piperidin-1-yl]sulfonylaniline (PubChem CID 170459185) has the molecular formula C13H14F6N2O2S and a molecular weight of 376.32 g/mol. Its IUPAC name is 2-(trifluoromethyl)-4-[3-(trifluoromethyl)piperidin-1-yl]sulfonylaniline.
| Compound Name | 2-(trifluoromethyl)-4-[3-(trifluoromethyl)piperidin-1-yl]sulfonylaniline |
|---|---|
| PubChem CID | 170459185 |
| Molecular Formula | C13H14F6N2O2S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-(trifluoromethyl)-4-[3-(trifluoromethyl)piperidin-1-yl]sulfonylaniline |
| SMILES | Nc1ccc(S(=O)(=O)N2CCCC(C(F)(F)F)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H14F6N2O2S/c14-12(15,16)8-2-1-5-21(7-8)24(22,23)9-3-4-11(20)10(6-9)13(17,18)19/h3-4,6,8H,1-2,5,7,20H2 |
| InChIKey | QDRKZHJKXABIRG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|