C13H15ClF3N3O2S — CID 120998766
5-(3-aminopiperidin-1-yl)sulfonyl-2-(trifluoromethyl)benzonitrile;hydrochloride (PubChem CID 120998766) has the molecular formula C13H15ClF3N3O2S and a molecular weight of 369.80 g/mol. Its IUPAC name is 5-(3-aminopiperidin-1-yl)sulfonyl-2-(trifluoromethyl)benzonitrile;hydrochloride.
| Compound Name | 5-(3-aminopiperidin-1-yl)sulfonyl-2-(trifluoromethyl)benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 120998766 |
| Molecular Formula | C13H15ClF3N3O2S |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 5-(3-aminopiperidin-1-yl)sulfonyl-2-(trifluoromethyl)benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cc(S(=O)(=O)N2CCCC(N)C2)ccc1C(F)(F)F |
| InChI | InChI=1S/C13H14F3N3O2S.ClH/c14-13(15,16)12-4-3-11(6-9(12)7-17)22(20,21)19-5-1-2-10(18)8-19;/h3-4,6,10H,1-2,5,8,18H2;1H |
| InChIKey | PDEHHNJEBRKHPW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |