C12H13ClF3N3O2S — CID 120999057
5-piperazin-1-ylsulfonyl-2-(trifluoromethyl)benzonitrile;hydrochloride (PubChem CID 120999057) has the molecular formula C12H13ClF3N3O2S and a molecular weight of 355.77 g/mol. Its IUPAC name is 5-piperazin-1-ylsulfonyl-2-(trifluoromethyl)benzonitrile;hydrochloride.
| Compound Name | 5-piperazin-1-ylsulfonyl-2-(trifluoromethyl)benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 120999057 |
| Molecular Formula | C12H13ClF3N3O2S |
| Molecular Weight | 355.77 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 5-piperazin-1-ylsulfonyl-2-(trifluoromethyl)benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cc(S(=O)(=O)N2CCNCC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3O2S.ClH/c13-12(14,15)11-2-1-10(7-9(11)8-16)21(19,20)18-5-3-17-4-6-18;/h1-2,7,17H,3-6H2;1H |
| InChIKey | HNMNPYOTOJCFFJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.77 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |