C11H12ClF3N2O2S — CID 2452153
1-[3-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 2452153) has the molecular formula C11H12ClF3N2O2S and a molecular weight of 328.74 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 2452153 |
| Molecular Formula | C11H12ClF3N2O2S |
| Molecular Weight | 328.74 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)c(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C11H12ClF3N2O2S/c12-10-7-8(1-2-9(10)11(13,14)15)20(18,19)17-5-3-16-4-6-17/h1-2,7,16H,3-6H2 |
| InChIKey | BEMAYTJPVZIWFN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.74 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |