C18H16ClF4NO4S2 — CID 90589940
1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine (PubChem CID 90589940) has the molecular formula C18H16ClF4NO4S2 and a molecular weight of 485.91 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 90589940 |
| Molecular Formula | C18H16ClF4NO4S2 |
| Molecular Weight | 485.91 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1CCN(S(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H16ClF4NO4S2/c19-17-6-5-15(11-16(17)18(21,22)23)30(27,28)24-9-7-14(8-10-24)29(25,26)13-3-1-12(20)2-4-13/h1-6,11,14H,7-10H2 |
| InChIKey | BISZKSKZSKLSQO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.91 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |