C19H19ClF3NO5S2 — CID 90592088
1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-(4-methoxyphenyl)sulfonylpiperidine (PubChem CID 90592088) has the molecular formula C19H19ClF3NO5S2 and a molecular weight of 497.94 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-(4-methoxyphenyl)sulfonylpiperidine.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-(4-methoxyphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 90592088 |
| Molecular Formula | C19H19ClF3NO5S2 |
| Molecular Weight | 497.94 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-4-(4-methoxyphenyl)sulfonylpiperidine |
| SMILES | COc1ccc(S(=O)(=O)C2CCN(S(=O)(=O)c3ccc(Cl)c(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H19ClF3NO5S2/c1-29-13-2-4-14(5-3-13)30(25,26)15-8-10-24(11-9-15)31(27,28)16-6-7-18(20)17(12-16)19(21,22)23/h2-7,12,15H,8-11H2,1H3 |
| InChIKey | PSZUXWWXJCYSOE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.94 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |