C19H20F3NO5S2 — CID 90592055
4-(4-methoxyphenyl)sulfonyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine (PubChem CID 90592055) has the molecular formula C19H20F3NO5S2 and a molecular weight of 463.50 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 90592055 |
| Molecular Formula | C19H20F3NO5S2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine |
| SMILES | COc1ccc(S(=O)(=O)C2CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H20F3NO5S2/c1-28-15-5-7-16(8-6-15)29(24,25)17-9-11-23(12-10-17)30(26,27)18-4-2-3-14(13-18)19(20,21)22/h2-8,13,17H,9-12H2,1H3 |
| InChIKey | ISIORZOBIXFDTL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |