C19H21F3N2O3S — CID 95110006
(2S)-2-(4-methoxyphenyl)-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 95110006) has the molecular formula C19H21F3N2O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenyl)-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | (2S)-2-(4-methoxyphenyl)-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 95110006 |
| Molecular Formula | C19H21F3N2O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (2S)-2-(4-methoxyphenyl)-1-methyl-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | COc1ccc([C@H]2CN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CCN2C)cc1 |
| InChI | InChI=1S/C19H21F3N2O3S/c1-23-10-11-24(13-18(23)14-6-8-16(27-2)9-7-14)28(25,26)17-5-3-4-15(12-17)19(20,21)22/h3-9,12,18H,10-11,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | IQICDQAFBBOZRL-GOSISDBHSA-N |
| XLogP | 3.39 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |