C20H22F3N3O4S — CID 17424565
N-(4-methoxyphenyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide (PubChem CID 17424565) has the molecular formula C20H22F3N3O4S and a molecular weight of 457.47 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 17424565 |
| Molecular Formula | C20H22F3N3O4S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide |
| SMILES | COc1ccc(NC(=O)CN2CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C20H22F3N3O4S/c1-30-17-7-5-16(6-8-17)24-19(27)14-25-9-11-26(12-10-25)31(28,29)18-4-2-3-15(13-18)20(21,22)23/h2-8,13H,9-12,14H2,1H3,(H,24,27) |
| InChIKey | DNQYPBRUDMZQTD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |