C20H22F3N3O4S — CID 3674696
2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 3674696) has the molecular formula C20H22F3N3O4S and a molecular weight of 457.47 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3674696 |
| Molecular Formula | C20H22F3N3O4S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(CC(=O)Nc3ccccc3C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C20H22F3N3O4S/c1-30-15-6-8-16(9-7-15)31(28,29)26-12-10-25(11-13-26)14-19(27)24-18-5-3-2-4-17(18)20(21,22)23/h2-9H,10-14H2,1H3,(H,24,27) |
| InChIKey | GZGIQURCTZCXKI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |