C23H24F3N3O6S — CID 98395197
(3S)-1-(2,4-dimethoxyphenyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 98395197) has the molecular formula C23H24F3N3O6S and a molecular weight of 527.52 g/mol. Its IUPAC name is (3S)-1-(2,4-dimethoxyphenyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2,4-dimethoxyphenyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98395197 |
| Molecular Formula | C23H24F3N3O6S |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | (3S)-1-(2,4-dimethoxyphenyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@H](N3CCN(S(=O)(=O)c4cccc(C(F)(F)F)c4)CC3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C23H24F3N3O6S/c1-34-16-6-7-18(20(13-16)35-2)29-21(30)14-19(22(29)31)27-8-10-28(11-9-27)36(32,33)17-5-3-4-15(12-17)23(24,25)26/h3-7,12-13,19H,8-11,14H2,1-2H3/t19-/m0/s1 |
| InChIKey | BJZDXFJIJCOAGI-IBGZPJMESA-N |
| XLogP | 2.36 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|