C18H25N3O5 — CID 93235137
(3S)-1-(2,4-dimethoxyphenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 93235137) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is (3S)-1-(2,4-dimethoxyphenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2,4-dimethoxyphenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 93235137 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (3S)-1-(2,4-dimethoxyphenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@H](N3CCN(CCO)CC3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C18H25N3O5/c1-25-13-3-4-14(16(11-13)26-2)21-17(23)12-15(18(21)24)20-7-5-19(6-8-20)9-10-22/h3-4,11,15,22H,5-10,12H2,1-2H3/t15-/m0/s1 |
| InChIKey | SNTLUFJEEVLWSK-HNNXBMFYSA-N |
| XLogP | -0.05 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|