C19H27N3O3 — CID 51859574
(3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione (PubChem CID 51859574) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51859574 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1cc(C)c(N2C(=O)C[C@@H](N3CCN(CCO)CC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C19H27N3O3/c1-13-10-14(2)18(15(3)11-13)22-17(24)12-16(19(22)25)21-6-4-20(5-7-21)8-9-23/h10-11,16,23H,4-9,12H2,1-3H3/t16-/m1/s1 |
| InChIKey | LVDPVHPXZAMZMQ-MRXNPFEDSA-N |
| XLogP | 0.85 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|