C20H27N3O4 — CID 51859546
ethyl 4-[(3R)-2,5-dioxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]piperazine-1-carboxylate (PubChem CID 51859546) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is ethyl 4-[(3R)-2,5-dioxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(3R)-2,5-dioxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 51859546 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | ethyl 4-[(3R)-2,5-dioxo-1-(2,4,6-trimethylphenyl)pyrrolidin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN([C@@H]2CC(=O)N(c3c(C)cc(C)cc3C)C2=O)CC1 |
| InChI | InChI=1S/C20H27N3O4/c1-5-27-20(26)22-8-6-21(7-9-22)16-12-17(24)23(19(16)25)18-14(3)10-13(2)11-15(18)4/h10-11,16H,5-9,12H2,1-4H3/t16-/m1/s1 |
| InChIKey | DRPFHUYIXNNWCY-MRXNPFEDSA-N |
| XLogP | 2.02 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|