C17H20IN3O4 — CID 2877440
ethyl 4-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carboxylate (PubChem CID 2877440) has the molecular formula C17H20IN3O4 and a molecular weight of 457.27 g/mol. Its IUPAC name is ethyl 4-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 2877440 |
| Molecular Formula | C17H20IN3O4 |
| Molecular Weight | 457.27 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | ethyl 4-[1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C2CC(=O)N(c3ccc(I)cc3)C2=O)CC1 |
| InChI | InChI=1S/C17H20IN3O4/c1-2-25-17(24)20-9-7-19(8-10-20)14-11-15(22)21(16(14)23)13-5-3-12(18)4-6-13/h3-6,14H,2,7-11H2,1H3 |
| InChIKey | XAIPWAKVVBHZRW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|