C16H20IN3O2 — CID 1091128
(3R)-3-(4-ethylpiperazin-1-yl)-1-(4-iodophenyl)pyrrolidine-2,5-dione (PubChem CID 1091128) has the molecular formula C16H20IN3O2 and a molecular weight of 413.26 g/mol. Its IUPAC name is (3R)-3-(4-ethylpiperazin-1-yl)-1-(4-iodophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-ethylpiperazin-1-yl)-1-(4-iodophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1091128 |
| Molecular Formula | C16H20IN3O2 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | (3R)-3-(4-ethylpiperazin-1-yl)-1-(4-iodophenyl)pyrrolidine-2,5-dione |
| SMILES | CCN1CCN([C@@H]2CC(=O)N(c3ccc(I)cc3)C2=O)CC1 |
| InChI | InChI=1S/C16H20IN3O2/c1-2-18-7-9-19(10-8-18)14-11-15(21)20(16(14)22)13-5-3-12(17)4-6-13/h3-6,14H,2,7-11H2,1H3/t14-/m1/s1 |
| InChIKey | BUJHBKSBRRCSBU-CQSZACIVSA-N |
| XLogP | 1.56 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|