C16H19F2N3O2 — CID 17228704
1-(3,4-difluorophenyl)-3-(4-ethylpiperazin-1-yl)pyrrolidine-2,5-dione (PubChem CID 17228704) has the molecular formula C16H19F2N3O2 and a molecular weight of 323.34 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(4-ethylpiperazin-1-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(3,4-difluorophenyl)-3-(4-ethylpiperazin-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 17228704 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(4-ethylpiperazin-1-yl)pyrrolidine-2,5-dione |
| SMILES | CCN1CCN(C2CC(=O)N(c3ccc(F)c(F)c3)C2=O)CC1 |
| InChI | InChI=1S/C16H19F2N3O2/c1-2-19-5-7-20(8-6-19)14-10-15(22)21(16(14)23)11-3-4-12(17)13(18)9-11/h3-4,9,14H,2,5-8,10H2,1H3 |
| InChIKey | ZSYRIWOZLSHTIP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|