C20H29N3O3 — CID 2273431
(3S)-1-(4-butoxyphenyl)-3-(4-ethylpiperazin-1-yl)pyrrolidine-2,5-dione (PubChem CID 2273431) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (3S)-1-(4-butoxyphenyl)-3-(4-ethylpiperazin-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-butoxyphenyl)-3-(4-ethylpiperazin-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2273431 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (3S)-1-(4-butoxyphenyl)-3-(4-ethylpiperazin-1-yl)pyrrolidine-2,5-dione |
| SMILES | CCCCOc1ccc(N2C(=O)C[C@H](N3CCN(CC)CC3)C2=O)cc1 |
| InChI | InChI=1S/C20H29N3O3/c1-3-5-14-26-17-8-6-16(7-9-17)23-19(24)15-18(20(23)25)22-12-10-21(4-2)11-13-22/h6-9,18H,3-5,10-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | XAZCFXHRXNSVCJ-SFHVURJKSA-N |
| XLogP | 2.13 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|