C22H32N2O4 — CID 5298896
1-(4-hexoxyphenyl)-3-(4-methoxypiperidin-1-yl)pyrrolidine-2,5-dione (PubChem CID 5298896) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 1-(4-hexoxyphenyl)-3-(4-methoxypiperidin-1-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-hexoxyphenyl)-3-(4-methoxypiperidin-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5298896 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 1-(4-hexoxyphenyl)-3-(4-methoxypiperidin-1-yl)pyrrolidine-2,5-dione |
| SMILES | CCCCCCOc1ccc(N2C(=O)CC(N3CCC(OC)CC3)C2=O)cc1 |
| InChI | InChI=1S/C22H32N2O4/c1-3-4-5-6-15-28-19-9-7-17(8-10-19)24-21(25)16-20(22(24)26)23-13-11-18(27-2)12-14-23/h7-10,18,20H,3-6,11-16H2,1-2H3 |
| InChIKey | BQBMQYDOMKWQOK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|