C22H33N2O4+ — CID 7335658
(3R)-1-(4-hexoxyphenyl)-3-(4-methoxypiperidin-1-ium-1-yl)pyrrolidine-2,5-dione (PubChem CID 7335658) has the molecular formula C22H33N2O4+ and a molecular weight of 389.52 g/mol. Its IUPAC name is (3R)-1-(4-hexoxyphenyl)-3-(4-methoxypiperidin-1-ium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-hexoxyphenyl)-3-(4-methoxypiperidin-1-ium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7335658 |
| Molecular Formula | C22H33N2O4+ |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (3R)-1-(4-hexoxyphenyl)-3-(4-methoxypiperidin-1-ium-1-yl)pyrrolidine-2,5-dione |
| SMILES | CCCCCCOc1ccc(N2C(=O)C[C@@H]([NH+]3CCC(OC)CC3)C2=O)cc1 |
| InChI | InChI=1S/C22H32N2O4/c1-3-4-5-6-15-28-19-9-7-17(8-10-19)24-21(25)16-20(22(24)26)23-13-11-18(27-2)12-14-23/h7-10,18,20H,3-6,11-16H2,1-2H3/p+1/t20-/m1/s1 |
| InChIKey | BQBMQYDOMKWQOK-HXUWFJFHSA-O |
| XLogP | 1.97 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|