C22H35N3O3+2 — CID 7377861
(3R)-3-(4-ethylpiperazine-1,4-diium-1-yl)-1-(4-hexoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 7377861) has the molecular formula C22H35N3O3+2 and a molecular weight of 389.54 g/mol. Its IUPAC name is (3R)-3-(4-ethylpiperazine-1,4-diium-1-yl)-1-(4-hexoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-ethylpiperazine-1,4-diium-1-yl)-1-(4-hexoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7377861 |
| Molecular Formula | C22H35N3O3+2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | (3R)-3-(4-ethylpiperazine-1,4-diium-1-yl)-1-(4-hexoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCCCCOc1ccc(N2C(=O)C[C@@H]([NH+]3CC[NH+](CC)CC3)C2=O)cc1 |
| InChI | InChI=1S/C22H33N3O3/c1-3-5-6-7-16-28-19-10-8-18(9-11-19)25-21(26)17-20(22(25)27)24-14-12-23(4-2)13-15-24/h8-11,20H,3-7,12-17H2,1-2H3/p+2/t20-/m1/s1 |
| InChIKey | QNZRVKFIGHOQNU-HXUWFJFHSA-P |
| XLogP | 0.08 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|