C16H23N3O2+2 — CID 6922165
(3R)-3-(4-ethylpiperazine-1,4-diium-1-yl)-1-phenylpyrrolidine-2,5-dione (PubChem CID 6922165) has the molecular formula C16H23N3O2+2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (3R)-3-(4-ethylpiperazine-1,4-diium-1-yl)-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-ethylpiperazine-1,4-diium-1-yl)-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6922165 |
| Molecular Formula | C16H23N3O2+2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (3R)-3-(4-ethylpiperazine-1,4-diium-1-yl)-1-phenylpyrrolidine-2,5-dione |
| SMILES | CC[NH+]1CC[NH+]([C@@H]2CC(=O)N(c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C16H21N3O2/c1-2-17-8-10-18(11-9-17)14-12-15(20)19(16(14)21)13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3/p+2/t14-/m1/s1 |
| InChIKey | VJYPVBPDHWHTOV-CQSZACIVSA-P |
| XLogP | -1.88 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|