C20H22N3O4S+ — CID 6973950
(3S)-3-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 6973950) has the molecular formula C20H22N3O4S+ and a molecular weight of 400.48 g/mol. Its IUPAC name is (3S)-3-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6973950 |
| Molecular Formula | C20H22N3O4S+ |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (3S)-3-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H]([NH+]2CCN(S(=O)(=O)c3ccccc3)CC2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H21N3O4S/c24-19-15-18(20(25)23(19)16-7-3-1-4-8-16)21-11-13-22(14-12-21)28(26,27)17-9-5-2-6-10-17/h1-10,18H,11-15H2/p+1/t18-/m0/s1 |
| InChIKey | SABICFKQWDLUMQ-SFHVURJKSA-O |
| XLogP | -0.09 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|