C24H29FN3O4S+ — CID 2125385
(3S)-3-[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-ium-1-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 2125385) has the molecular formula C24H29FN3O4S+ and a molecular weight of 474.58 g/mol. Its IUPAC name is (3S)-3-[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-ium-1-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-ium-1-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2125385 |
| Molecular Formula | C24H29FN3O4S+ |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (3S)-3-[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-ium-1-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | CC[C@@H](C)c1ccc(S(=O)(=O)N2CC[NH+]([C@H]3CC(=O)N(c4ccc(F)cc4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C24H28FN3O4S/c1-3-17(2)18-4-10-21(11-5-18)33(31,32)27-14-12-26(13-15-27)22-16-23(29)28(24(22)30)20-8-6-19(25)7-9-20/h4-11,17,22H,3,12-16H2,1-2H3/p+1/t17-,22+/m1/s1 |
| InChIKey | VLHNWAXCWJENTH-VGSWGCGISA-O |
| XLogP | 1.56 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|