C20H28N3O5S+ — CID 4229549
3-(4-methylpiperidin-1-ium-1-yl)-1-(4-morpholin-4-ylsulfonylphenyl)pyrrolidine-2,5-dione (PubChem CID 4229549) has the molecular formula C20H28N3O5S+ and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-(4-methylpiperidin-1-ium-1-yl)-1-(4-morpholin-4-ylsulfonylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(4-methylpiperidin-1-ium-1-yl)-1-(4-morpholin-4-ylsulfonylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4229549 |
| Molecular Formula | C20H28N3O5S+ |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 3-(4-methylpiperidin-1-ium-1-yl)-1-(4-morpholin-4-ylsulfonylphenyl)pyrrolidine-2,5-dione |
| SMILES | CC1CC[NH+](C2CC(=O)N(c3ccc(S(=O)(=O)N4CCOCC4)cc3)C2=O)CC1 |
| InChI | InChI=1S/C20H27N3O5S/c1-15-6-8-21(9-7-15)18-14-19(24)23(20(18)25)16-2-4-17(5-3-16)29(26,27)22-10-12-28-13-11-22/h2-5,15,18H,6-14H2,1H3/p+1 |
| InChIKey | LITMOHOBEYXEOL-UHFFFAOYSA-O |
| XLogP | -0.35 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|