C21H23FN3O5S+ — CID 2116340
(3S)-3-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 2116340) has the molecular formula C21H23FN3O5S+ and a molecular weight of 448.50 g/mol. Its IUPAC name is (3S)-3-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2116340 |
| Molecular Formula | C21H23FN3O5S+ |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (3S)-3-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-(4-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@H]([NH+]3CCN(S(=O)(=O)c4ccccc4F)CC3)C2=O)cc1 |
| InChI | InChI=1S/C21H22FN3O5S/c1-30-16-8-6-15(7-9-16)25-20(26)14-18(21(25)27)23-10-12-24(13-11-23)31(28,29)19-5-3-2-4-17(19)22/h2-9,18H,10-14H2,1H3/p+1/t18-/m0/s1 |
| InChIKey | QJTPJYHPLQABDM-SFHVURJKSA-O |
| XLogP | 0.06 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|