C20H21FN3O2+ — CID 6965105
(3S)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 6965105) has the molecular formula C20H21FN3O2+ and a molecular weight of 354.40 g/mol. Its IUPAC name is (3S)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6965105 |
| Molecular Formula | C20H21FN3O2+ |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (3S)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H]([NH+]2CCN(c3ccccc3F)CC2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H20FN3O2/c21-16-8-4-5-9-17(16)22-10-12-23(13-11-22)18-14-19(25)24(20(18)26)15-6-2-1-3-7-15/h1-9,18H,10-14H2/p+1/t18-/m0/s1 |
| InChIKey | BXSLYZAKCKPTHE-SFHVURJKSA-O |
| XLogP | 0.86 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|