C20H20Cl2N3O2+ — CID 4121741
1-(2,4-dichlorophenyl)-3-(4-phenylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione (PubChem CID 4121741) has the molecular formula C20H20Cl2N3O2+ and a molecular weight of 405.31 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(4-phenylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(4-phenylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4121741 |
| Molecular Formula | C20H20Cl2N3O2+ |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(4-phenylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC([NH+]2CCN(c3ccccc3)CC2)C(=O)N1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H19Cl2N3O2/c21-14-6-7-17(16(22)12-14)25-19(26)13-18(20(25)27)24-10-8-23(9-11-24)15-4-2-1-3-5-15/h1-7,12,18H,8-11,13H2/p+1 |
| InChIKey | JUYQIRYAXHGLRP-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|