C20H21ClN3O3+ — CID 7465030
(3R)-1-(4-chlorophenyl)-3-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 7465030) has the molecular formula C20H21ClN3O3+ and a molecular weight of 386.86 g/mol. Its IUPAC name is (3R)-1-(4-chlorophenyl)-3-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-chlorophenyl)-3-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7465030 |
| Molecular Formula | C20H21ClN3O3+ |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (3R)-1-(4-chlorophenyl)-3-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CCN(c3ccc(O)cc3)CC2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClN3O3/c21-14-1-3-16(4-2-14)24-19(26)13-18(20(24)27)23-11-9-22(10-12-23)15-5-7-17(25)8-6-15/h1-8,18,25H,9-13H2/p+1/t18-/m1/s1 |
| InChIKey | VJVRJUHWOWKTHB-GOSISDBHSA-O |
| XLogP | 1.08 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|