C19H26N3O5+ — CID 7456165
tert-butyl 4-[(3S)-1-(4-hydroxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carboxylate (PubChem CID 7456165) has the molecular formula C19H26N3O5+ and a molecular weight of 376.43 g/mol. Its IUPAC name is tert-butyl 4-[(3S)-1-(4-hydroxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carboxylate.
| Compound Name | tert-butyl 4-[(3S)-1-(4-hydroxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 7456165 |
| Molecular Formula | C19H26N3O5+ |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | tert-butyl 4-[(3S)-1-(4-hydroxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[NH+]([C@H]2CC(=O)N(c3ccc(O)cc3)C2=O)CC1 |
| InChI | InChI=1S/C19H25N3O5/c1-19(2,3)27-18(26)21-10-8-20(9-11-21)15-12-16(24)22(17(15)25)13-4-6-14(23)7-5-13/h4-7,15,23H,8-12H2,1-3H3/p+1/t15-/m0/s1 |
| InChIKey | GTZWYUFQILWIKP-HNNXBMFYSA-O |
| XLogP | 0.16 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|