C19H26N3O4+ — CID 2242231
ethyl 4-[(3R)-1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carboxylate (PubChem CID 2242231) has the molecular formula C19H26N3O4+ and a molecular weight of 360.43 g/mol. Its IUPAC name is ethyl 4-[(3R)-1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[(3R)-1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 2242231 |
| Molecular Formula | C19H26N3O4+ |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | ethyl 4-[(3R)-1-(4-ethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+]([C@@H]2CC(=O)N(c3ccc(CC)cc3)C2=O)CC1 |
| InChI | InChI=1S/C19H25N3O4/c1-3-14-5-7-15(8-6-14)22-17(23)13-16(18(22)24)20-9-11-21(12-10-20)19(25)26-4-2/h5-8,16H,3-4,9-13H2,1-2H3/p+1/t16-/m1/s1 |
| InChIKey | IITUPEZJVMLIEG-MRXNPFEDSA-O |
| XLogP | 0.24 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|