C20H27N2O5+ — CID 6967905
ethyl 1-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxylate (PubChem CID 6967905) has the molecular formula C20H27N2O5+ and a molecular weight of 375.45 g/mol. Its IUPAC name is ethyl 1-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 6967905 |
| Molecular Formula | C20H27N2O5+ |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | ethyl 1-[(3R)-1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+]([C@@H]2CC(=O)N(c3ccc(OCC)cc3)C2=O)CC1 |
| InChI | InChI=1S/C20H26N2O5/c1-3-26-16-7-5-15(6-8-16)22-18(23)13-17(19(22)24)21-11-9-14(10-12-21)20(25)27-4-2/h5-8,14,17H,3-4,9-13H2,1-2H3/p+1/t17-/m1/s1 |
| InChIKey | AYOKQMIIBYNDPC-QGZVFWFLSA-O |
| XLogP | 0.58 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|