C23H27FN3O3+ — CID 7327543
(3S)-3-[4-(4-ethoxyanilino)piperidin-1-ium-1-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 7327543) has the molecular formula C23H27FN3O3+ and a molecular weight of 412.49 g/mol. Its IUPAC name is (3S)-3-[4-(4-ethoxyanilino)piperidin-1-ium-1-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-(4-ethoxyanilino)piperidin-1-ium-1-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7327543 |
| Molecular Formula | C23H27FN3O3+ |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (3S)-3-[4-(4-ethoxyanilino)piperidin-1-ium-1-yl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(NC2CC[NH+]([C@H]3CC(=O)N(c4ccc(F)cc4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C23H26FN3O3/c1-2-30-20-9-5-17(6-10-20)25-18-11-13-26(14-12-18)21-15-22(28)27(23(21)29)19-7-3-16(24)4-8-19/h3-10,18,21,25H,2,11-15H2,1H3/p+1/t21-/m0/s1 |
| InChIKey | LTAVZZWYYZPJAC-NRFANRHFSA-O |
| XLogP | 2.02 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|