C21H22ClFN3O2+ — CID 7298611
(3R)-1-(4-chlorophenyl)-3-[4-(4-fluoroanilino)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 7298611) has the molecular formula C21H22ClFN3O2+ and a molecular weight of 402.88 g/mol. Its IUPAC name is (3R)-1-(4-chlorophenyl)-3-[4-(4-fluoroanilino)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-chlorophenyl)-3-[4-(4-fluoroanilino)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7298611 |
| Molecular Formula | C21H22ClFN3O2+ |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (3R)-1-(4-chlorophenyl)-3-[4-(4-fluoroanilino)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CCC(Nc3ccc(F)cc3)CC2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClFN3O2/c22-14-1-7-18(8-2-14)26-20(27)13-19(21(26)28)25-11-9-17(10-12-25)24-16-5-3-15(23)4-6-16/h1-8,17,19,24H,9-13H2/p+1/t19-/m1/s1 |
| InChIKey | RONKPWXRKIXARG-LJQANCHMSA-O |
| XLogP | 2.27 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|