C15H18FN2O3+ — CID 6937602
(3S)-1-(4-fluorophenyl)-3-(4-hydroxypiperidin-1-ium-1-yl)pyrrolidine-2,5-dione (PubChem CID 6937602) has the molecular formula C15H18FN2O3+ and a molecular weight of 293.32 g/mol. Its IUPAC name is (3S)-1-(4-fluorophenyl)-3-(4-hydroxypiperidin-1-ium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-fluorophenyl)-3-(4-hydroxypiperidin-1-ium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6937602 |
| Molecular Formula | C15H18FN2O3+ |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (3S)-1-(4-fluorophenyl)-3-(4-hydroxypiperidin-1-ium-1-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H]([NH+]2CCC(O)CC2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H17FN2O3/c16-10-1-3-11(4-2-10)18-14(20)9-13(15(18)21)17-7-5-12(19)6-8-17/h1-4,12-13,19H,5-9H2/p+1/t13-/m0/s1 |
| InChIKey | XMWKAKUJKBKUJC-ZDUSSCGKSA-O |
| XLogP | -0.50 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|