C23H35N3O4+2 — CID 7335650
(3R)-1-(4-ethoxyphenyl)-3-[4-(2-morpholin-4-ium-4-ylethyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 7335650) has the molecular formula C23H35N3O4+2 and a molecular weight of 417.55 g/mol. Its IUPAC name is (3R)-1-(4-ethoxyphenyl)-3-[4-(2-morpholin-4-ium-4-ylethyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-ethoxyphenyl)-3-[4-(2-morpholin-4-ium-4-ylethyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7335650 |
| Molecular Formula | C23H35N3O4+2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | (3R)-1-(4-ethoxyphenyl)-3-[4-(2-morpholin-4-ium-4-ylethyl)piperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)C[C@@H]([NH+]3CCC(CC[NH+]4CCOCC4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H33N3O4/c1-2-30-20-5-3-19(4-6-20)26-22(27)17-21(23(26)28)25-11-8-18(9-12-25)7-10-24-13-15-29-16-14-24/h3-6,18,21H,2,7-17H2,1H3/p+2/t21-/m1/s1 |
| InChIKey | AJDGTHVZKGEGJG-OAQYLSRUSA-P |
| XLogP | -0.68 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|