C18H23N2O5+ — CID 7323101
ethyl 2-[4-[(3S)-3-morpholin-4-ium-4-yl-2,5-dioxopyrrolidin-1-yl]phenyl]acetate (PubChem CID 7323101) has the molecular formula C18H23N2O5+ and a molecular weight of 347.39 g/mol. Its IUPAC name is ethyl 2-[4-[(3S)-3-morpholin-4-ium-4-yl-2,5-dioxopyrrolidin-1-yl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[(3S)-3-morpholin-4-ium-4-yl-2,5-dioxopyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 7323101 |
| Molecular Formula | C18H23N2O5+ |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | ethyl 2-[4-[(3S)-3-morpholin-4-ium-4-yl-2,5-dioxopyrrolidin-1-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)C[C@H]([NH+]3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C18H22N2O5/c1-2-25-17(22)11-13-3-5-14(6-4-13)20-16(21)12-15(18(20)23)19-7-9-24-10-8-19/h3-6,15H,2,7-12H2,1H3/p+1/t15-/m0/s1 |
| InChIKey | QZKNOCNYLFSPJL-HNNXBMFYSA-O |
| XLogP | -0.66 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|