C19H25N2O4+ — CID 7323104
ethyl 2-[4-[(3R)-2,5-dioxo-3-piperidin-1-ium-1-ylpyrrolidin-1-yl]phenyl]acetate (PubChem CID 7323104) has the molecular formula C19H25N2O4+ and a molecular weight of 345.42 g/mol. Its IUPAC name is ethyl 2-[4-[(3R)-2,5-dioxo-3-piperidin-1-ium-1-ylpyrrolidin-1-yl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[(3R)-2,5-dioxo-3-piperidin-1-ium-1-ylpyrrolidin-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 7323104 |
| Molecular Formula | C19H25N2O4+ |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | ethyl 2-[4-[(3R)-2,5-dioxo-3-piperidin-1-ium-1-ylpyrrolidin-1-yl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(N2C(=O)C[C@@H]([NH+]3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C19H24N2O4/c1-2-25-18(23)12-14-6-8-15(9-7-14)21-17(22)13-16(19(21)24)20-10-4-3-5-11-20/h6-9,16H,2-5,10-13H2,1H3/p+1/t16-/m1/s1 |
| InChIKey | FHNNEVDMADQLDS-MRXNPFEDSA-O |
| XLogP | 0.49 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|