C17H25N3O2+2 — CID 4184963
3-(4-methyl-1,4-diazepane-1,4-diium-1-yl)-1-(4-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 4184963) has the molecular formula C17H25N3O2+2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-(4-methyl-1,4-diazepane-1,4-diium-1-yl)-1-(4-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(4-methyl-1,4-diazepane-1,4-diium-1-yl)-1-(4-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4184963 |
| Molecular Formula | C17H25N3O2+2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 3-(4-methyl-1,4-diazepane-1,4-diium-1-yl)-1-(4-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)CC([NH+]3CCC[NH+](C)CC3)C2=O)cc1 |
| InChI | InChI=1S/C17H23N3O2/c1-13-4-6-14(7-5-13)20-16(21)12-15(17(20)22)19-9-3-8-18(2)10-11-19/h4-7,15H,3,8-12H2,1-2H3/p+2 |
| InChIKey | CEXFGCVTGHXTMZ-UHFFFAOYSA-P |
| XLogP | -1.57 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|