C17H23N2O2+ — CID 7448616
(3S)-1-(4-methylphenyl)-3-[(3S)-3-methylpiperidin-1-ium-1-yl]pyrrolidine-2,5-dione (PubChem CID 7448616) has the molecular formula C17H23N2O2+ and a molecular weight of 287.38 g/mol. Its IUPAC name is (3S)-1-(4-methylphenyl)-3-[(3S)-3-methylpiperidin-1-ium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-methylphenyl)-3-[(3S)-3-methylpiperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7448616 |
| Molecular Formula | C17H23N2O2+ |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | (3S)-1-(4-methylphenyl)-3-[(3S)-3-methylpiperidin-1-ium-1-yl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@H]([NH+]3CCC[C@H](C)C3)C2=O)cc1 |
| InChI | InChI=1S/C17H22N2O2/c1-12-5-7-14(8-6-12)19-16(20)10-15(17(19)21)18-9-3-4-13(2)11-18/h5-8,13,15H,3-4,9-11H2,1-2H3/p+1/t13-,15-/m0/s1 |
| InChIKey | NXMVCEDSFVCNKZ-ZFWWWQNUSA-O |
| XLogP | 0.94 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|