C16H20N3O3+ — CID 5043904
1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)piperidin-1-ium-3-carboxamide (PubChem CID 5043904) has the molecular formula C16H20N3O3+ and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)piperidin-1-ium-3-carboxamide.
| Compound Name | 1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 5043904 |
| Molecular Formula | C16H20N3O3+ |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-(2,5-dioxo-1-phenylpyrrolidin-3-yl)piperidin-1-ium-3-carboxamide |
| SMILES | NC(=O)C1CCC[NH+](C2CC(=O)N(c3ccccc3)C2=O)C1 |
| InChI | InChI=1S/C16H19N3O3/c17-15(21)11-5-4-8-18(10-11)13-9-14(20)19(16(13)22)12-6-2-1-3-7-12/h1-3,6-7,11,13H,4-5,8-10H2,(H2,17,21)/p+1 |
| InChIKey | MLZJDHFHGJFLBQ-UHFFFAOYSA-O |
| XLogP | -0.90 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|