C16H19ClN3O3+ — CID 6952991
1-[(3S)-1-(2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide (PubChem CID 6952991) has the molecular formula C16H19ClN3O3+ and a molecular weight of 336.80 g/mol. Its IUPAC name is 1-[(3S)-1-(2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(3S)-1-(2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6952991 |
| Molecular Formula | C16H19ClN3O3+ |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-[(3S)-1-(2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+]([C@H]2CC(=O)N(c3ccccc3Cl)C2=O)CC1 |
| InChI | InChI=1S/C16H18ClN3O3/c17-11-3-1-2-4-12(11)20-14(21)9-13(16(20)23)19-7-5-10(6-8-19)15(18)22/h1-4,10,13H,5-9H2,(H2,18,22)/p+1/t13-/m0/s1 |
| InChIKey | KLIVEUSSOHBTCR-ZDUSSCGKSA-O |
| XLogP | -0.25 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|