C17H18ClF3N3O3+ — CID 5065824
1-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide (PubChem CID 5065824) has the molecular formula C17H18ClF3N3O3+ and a molecular weight of 404.80 g/mol. Its IUPAC name is 1-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 5065824 |
| Molecular Formula | C17H18ClF3N3O3+ |
| Molecular Weight | 404.80 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 1-[1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+](C2CC(=O)N(c3ccc(Cl)c(C(F)(F)F)c3)C2=O)CC1 |
| InChI | InChI=1S/C17H17ClF3N3O3/c18-12-2-1-10(7-11(12)17(19,20)21)24-14(25)8-13(16(24)27)23-5-3-9(4-6-23)15(22)26/h1-2,7,9,13H,3-6,8H2,(H2,22,26)/p+1 |
| InChIKey | WWOQJYBDFRQEGK-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.80 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|