C22H26ClF3N4O3 — CID 1307651
1-[(3R)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]-4-piperidin-1-ylpiperidine-4-carboxamide (PubChem CID 1307651) has the molecular formula C22H26ClF3N4O3 and a molecular weight of 486.92 g/mol. Its IUPAC name is 1-[(3R)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]-4-piperidin-1-ylpiperidine-4-carboxamide.
| Compound Name | 1-[(3R)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]-4-piperidin-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 1307651 |
| Molecular Formula | C22H26ClF3N4O3 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 1-[(3R)-1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dioxopyrrolidin-3-yl]-4-piperidin-1-ylpiperidine-4-carboxamide |
| SMILES | NC(=O)C1(N2CCCCC2)CCN([C@@H]2CC(=O)N(c3ccc(Cl)c(C(F)(F)F)c3)C2=O)CC1 |
| InChI | InChI=1S/C22H26ClF3N4O3/c23-16-5-4-14(12-15(16)22(24,25)26)30-18(31)13-17(19(30)32)28-10-6-21(7-11-28,20(27)33)29-8-2-1-3-9-29/h4-5,12,17H,1-3,6-11,13H2,(H2,27,33)/t17-/m1/s1 |
| InChIKey | MWACWQALSXXCQQ-QGZVFWFLSA-N |
| XLogP | 2.80 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|