C14H14Cl2N2O2 — CID 683224
(3S)-1-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpyrrolidine-2,5-dione (PubChem CID 683224) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is (3S)-1-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 683224 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (3S)-1-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](N2CCCC2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c15-10-4-3-9(7-11(10)16)18-13(19)8-12(14(18)20)17-5-1-2-6-17/h3-4,7,12H,1-2,5-6,8H2/t12-/m0/s1 |
| InChIKey | UKEHKESLAWFLEM-LBPRGKRZSA-N |
| XLogP | 2.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|